C23H36N4O2S — CID 3185902
1-[3-(diethylamino)propyl]-1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-methoxyethyl)thiourea (PubChem CID 3185902) has the molecular formula C23H36N4O2S and a molecular weight of 432.63 g/mol. Its IUPAC name is 1-[3-(diethylamino)propyl]-1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-methoxyethyl)thiourea.
| Compound Name | 1-[3-(diethylamino)propyl]-1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-methoxyethyl)thiourea |
|---|---|
| PubChem CID | 3185902 |
| Molecular Formula | C23H36N4O2S |
| Molecular Weight | 432.63 g/mol |
| Exact Mass | 432.26 |
| IUPAC Name | 1-[3-(diethylamino)propyl]-1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-methoxyethyl)thiourea |
| SMILES | CCc1ccc2[nH]c(=O)c(CN(CCCN(CC)CC)C(=S)NCCOC)cc2c1 |
| InChI | InChI=1S/C23H36N4O2S/c1-5-18-9-10-21-19(15-18)16-20(22(28)25-21)17-27(23(30)24-11-14-29-4)13-8-12-26(6-2)7-3/h9-10,15-16H,5-8,11-14,17H2,1-4H3,(H,24,30)(H,25,28) |
| InChIKey | NGOWMIIUIDFWJD-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.63 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|