C22H29N4O2S+ — CID 7107874
3-[[furan-2-ylmethyl-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]carbamothioyl]amino]propyl-dimethylazanium (PubChem CID 7107874) has the molecular formula C22H29N4O2S+ and a molecular weight of 413.57 g/mol. Its IUPAC name is 3-[[furan-2-ylmethyl-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]carbamothioyl]amino]propyl-dimethylazanium.
| Compound Name | 3-[[furan-2-ylmethyl-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]carbamothioyl]amino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 7107874 |
| Molecular Formula | C22H29N4O2S+ |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 3-[[furan-2-ylmethyl-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]carbamothioyl]amino]propyl-dimethylazanium |
| SMILES | Cc1ccc2[nH]c(=O)c(CN(Cc3ccco3)C(=S)NCCC[NH+](C)C)cc2c1 |
| InChI | InChI=1S/C22H28N4O2S/c1-16-7-8-20-17(12-16)13-18(21(27)24-20)14-26(15-19-6-4-11-28-19)22(29)23-9-5-10-25(2)3/h4,6-8,11-13H,5,9-10,14-15H2,1-3H3,(H,23,29)(H,24,27)/p+1 |
| InChIKey | MKCWCOOYXAZLSB-UHFFFAOYSA-O |
| XLogP | 1.84 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|