C22H25N3O2S2 — CID 1141423
1-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]-3-[[(2R)-oxolan-2-yl]methyl]-1-(thiophen-2-ylmethyl)thiourea (PubChem CID 1141423) has the molecular formula C22H25N3O2S2 and a molecular weight of 427.60 g/mol. Its IUPAC name is 1-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]-3-[[(2R)-oxolan-2-yl]methyl]-1-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 1-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]-3-[[(2R)-oxolan-2-yl]methyl]-1-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 1141423 |
| Molecular Formula | C22H25N3O2S2 |
| Molecular Weight | 427.60 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 1-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]-3-[[(2R)-oxolan-2-yl]methyl]-1-(thiophen-2-ylmethyl)thiourea |
| SMILES | Cc1ccc2cc(CN(Cc3cccs3)C(=S)NC[C@H]3CCCO3)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C22H25N3O2S2/c1-15-6-7-16-11-17(21(26)24-20(16)10-15)13-25(14-19-5-3-9-29-19)22(28)23-12-18-4-2-8-27-18/h3,5-7,9-11,18H,2,4,8,12-14H2,1H3,(H,23,28)(H,24,26)/t18-/m1/s1 |
| InChIKey | GDCUMRXWZYSEHN-GOSISDBHSA-N |
| XLogP | 3.95 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.60 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|