C23H27N3O4S2 — CID 3177203
1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(oxolan-2-ylmethyl)-1-(thiophen-2-ylmethyl)thiourea (PubChem CID 3177203) has the molecular formula C23H27N3O4S2 and a molecular weight of 473.62 g/mol. Its IUPAC name is 1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(oxolan-2-ylmethyl)-1-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(oxolan-2-ylmethyl)-1-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 3177203 |
| Molecular Formula | C23H27N3O4S2 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | 1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(oxolan-2-ylmethyl)-1-(thiophen-2-ylmethyl)thiourea |
| SMILES | COc1cc2cc(CN(Cc3cccs3)C(=S)NCC3CCCO3)c(=O)[nH]c2cc1OC |
| InChI | InChI=1S/C23H27N3O4S2/c1-28-20-10-15-9-16(22(27)25-19(15)11-21(20)29-2)13-26(14-18-6-4-8-32-18)23(31)24-12-17-5-3-7-30-17/h4,6,8-11,17H,3,5,7,12-14H2,1-2H3,(H,24,31)(H,25,27) |
| InChIKey | SEJFEUNVFZQCES-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 75.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|