C27H33N3O4S — CID 1150005
1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-[2-(2-methylphenyl)ethyl]-3-[[(2S)-oxolan-2-yl]methyl]thiourea (PubChem CID 1150005) has the molecular formula C27H33N3O4S and a molecular weight of 495.65 g/mol. Its IUPAC name is 1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-[2-(2-methylphenyl)ethyl]-3-[[(2S)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-[2-(2-methylphenyl)ethyl]-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 1150005 |
| Molecular Formula | C27H33N3O4S |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | 1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-[2-(2-methylphenyl)ethyl]-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
| SMILES | COc1cc2cc(CN(CCc3ccccc3C)C(=S)NC[C@@H]3CCCO3)c(=O)[nH]c2cc1OC |
| InChI | InChI=1S/C27H33N3O4S/c1-18-7-4-5-8-19(18)10-11-30(27(35)28-16-22-9-6-12-34-22)17-21-13-20-14-24(32-2)25(33-3)15-23(20)29-26(21)31/h4-5,7-8,13-15,22H,6,9-12,16-17H2,1-3H3,(H,28,35)(H,29,31)/t22-/m0/s1 |
| InChIKey | KCEZZDYUAPKRNL-QFIPXVFZSA-N |
| XLogP | 3.95 |
| TPSA | 75.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|