C25H25N3OS2 — CID 1149507
3-(2-ethylphenyl)-1-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(thiophen-2-ylmethyl)thiourea (PubChem CID 1149507) has the molecular formula C25H25N3OS2 and a molecular weight of 447.63 g/mol. Its IUPAC name is 3-(2-ethylphenyl)-1-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 3-(2-ethylphenyl)-1-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 1149507 |
| Molecular Formula | C25H25N3OS2 |
| Molecular Weight | 447.63 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | 3-(2-ethylphenyl)-1-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(thiophen-2-ylmethyl)thiourea |
| SMILES | CCc1ccccc1NC(=S)N(Cc1cccs1)Cc1cc2cccc(C)c2[nH]c1=O |
| InChI | InChI=1S/C25H25N3OS2/c1-3-18-9-4-5-12-22(18)26-25(30)28(16-21-11-7-13-31-21)15-20-14-19-10-6-8-17(2)23(19)27-24(20)29/h4-14H,3,15-16H2,1-2H3,(H,26,30)(H,27,29) |
| InChIKey | HJQXQYYAJWHNLX-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.63 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|