C27H36N4OS — CID 3177018
1-[2-(diethylamino)ethyl]-1-[(5,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-ethylphenyl)thiourea (PubChem CID 3177018) has the molecular formula C27H36N4OS and a molecular weight of 464.68 g/mol. Its IUPAC name is 1-[2-(diethylamino)ethyl]-1-[(5,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-ethylphenyl)thiourea.
| Compound Name | 1-[2-(diethylamino)ethyl]-1-[(5,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-ethylphenyl)thiourea |
|---|---|
| PubChem CID | 3177018 |
| Molecular Formula | C27H36N4OS |
| Molecular Weight | 464.68 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | 1-[2-(diethylamino)ethyl]-1-[(5,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-ethylphenyl)thiourea |
| SMILES | CCc1ccccc1NC(=S)N(CCN(CC)CC)Cc1cc2c(C)ccc(C)c2[nH]c1=O |
| InChI | InChI=1S/C27H36N4OS/c1-6-21-11-9-10-12-24(21)28-27(33)31(16-15-30(7-2)8-3)18-22-17-23-19(4)13-14-20(5)25(23)29-26(22)32/h9-14,17H,6-8,15-16,18H2,1-5H3,(H,28,33)(H,29,32) |
| InChIKey | VUKNSALKWZGFEA-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 51.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.68 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|