C26H35N5OS — CID 3171734
3-[3-(diethylamino)propyl]-1-[(5,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(pyridin-3-ylmethyl)thiourea (PubChem CID 3171734) has the molecular formula C26H35N5OS and a molecular weight of 465.67 g/mol. Its IUPAC name is 3-[3-(diethylamino)propyl]-1-[(5,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 3-[3-(diethylamino)propyl]-1-[(5,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 3171734 |
| Molecular Formula | C26H35N5OS |
| Molecular Weight | 465.67 g/mol |
| Exact Mass | 465.26 |
| IUPAC Name | 3-[3-(diethylamino)propyl]-1-[(5,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(pyridin-3-ylmethyl)thiourea |
| SMILES | CCN(CC)CCCNC(=S)N(Cc1cccnc1)Cc1cc2c(C)ccc(C)c2[nH]c1=O |
| InChI | InChI=1S/C26H35N5OS/c1-5-30(6-2)14-8-13-28-26(33)31(17-21-9-7-12-27-16-21)18-22-15-23-19(3)10-11-20(4)24(23)29-25(22)32/h7,9-12,15-16H,5-6,8,13-14,17-18H2,1-4H3,(H,28,33)(H,29,32) |
| InChIKey | IJJWKDFRQAWAOD-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.67 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|