C23H35N5S — CID 3257613
3-[3-(diethylamino)propyl]-1-[[4-(dimethylamino)phenyl]methyl]-1-(pyridin-3-ylmethyl)thiourea (PubChem CID 3257613) has the molecular formula C23H35N5S and a molecular weight of 413.64 g/mol. Its IUPAC name is 3-[3-(diethylamino)propyl]-1-[[4-(dimethylamino)phenyl]methyl]-1-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 3-[3-(diethylamino)propyl]-1-[[4-(dimethylamino)phenyl]methyl]-1-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 3257613 |
| Molecular Formula | C23H35N5S |
| Molecular Weight | 413.64 g/mol |
| Exact Mass | 413.26 |
| IUPAC Name | 3-[3-(diethylamino)propyl]-1-[[4-(dimethylamino)phenyl]methyl]-1-(pyridin-3-ylmethyl)thiourea |
| SMILES | CCN(CC)CCCNC(=S)N(Cc1ccc(N(C)C)cc1)Cc1cccnc1 |
| InChI | InChI=1S/C23H35N5S/c1-5-27(6-2)16-8-15-25-23(29)28(19-21-9-7-14-24-17-21)18-20-10-12-22(13-11-20)26(3)4/h7,9-14,17H,5-6,8,15-16,18-19H2,1-4H3,(H,25,29) |
| InChIKey | YQCOWYPTOGGSLQ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 34.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.64 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|