C20H26N4OS — CID 5128589
2-[[benzyl(pyridin-3-ylmethyl)carbamothioyl]amino]-N-butan-2-ylacetamide (PubChem CID 5128589) has the molecular formula C20H26N4OS and a molecular weight of 370.52 g/mol. Its IUPAC name is 2-[[benzyl(pyridin-3-ylmethyl)carbamothioyl]amino]-N-butan-2-ylacetamide.
| Compound Name | 2-[[benzyl(pyridin-3-ylmethyl)carbamothioyl]amino]-N-butan-2-ylacetamide |
|---|---|
| PubChem CID | 5128589 |
| Molecular Formula | C20H26N4OS |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 2-[[benzyl(pyridin-3-ylmethyl)carbamothioyl]amino]-N-butan-2-ylacetamide |
| SMILES | CCC(C)NC(=O)CNC(=S)N(Cc1ccccc1)Cc1cccnc1 |
| InChI | InChI=1S/C20H26N4OS/c1-3-16(2)23-19(25)13-22-20(26)24(14-17-8-5-4-6-9-17)15-18-10-7-11-21-12-18/h4-12,16H,3,13-15H2,1-2H3,(H,22,26)(H,23,25) |
| InChIKey | IIDFUUCBBGVFIM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|