2-(butan-2-ylamino)acetic acid;3-pyridin-3-ylpropanoic acid

C14H22N2O4 — CID 67301169

IUPAC2-(butan-2-ylamino)acetic acid;3-pyridin-3-ylpropanoic acid
SMILESCCC(C)NCC(=O)O.O=C(O)CCc1cccnc1
InChIInChI=1S/C8H9NO2.C6H13NO2/c10-8(11)4-3-7-2-1-5-9-6-7;1-3-5(2)7-4-6(8)9/h1-2,5-6H,3-4H2,(H,10,11);5,7H,3-4H2,1-2H3,(H,8,9)
InChIKeyFUXNMKNUJMETFQ-UHFFFAOYSA-N
MW282.34 g/mol
LogP1.56
Rot. Bonds7

About 2-(butan-2-ylamino)acetic acid;3-pyridin-3-ylpropanoic acid

2-(butan-2-ylamino)acetic acid;3-pyridin-3-ylpropanoic acid (PubChem CID 67301169) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is 2-(butan-2-ylamino)acetic acid;3-pyridin-3-ylpropanoic acid.

Molecular Properties

Compound Name2-(butan-2-ylamino)acetic acid;3-pyridin-3-ylpropanoic acid
PubChem CID67301169
Molecular FormulaC14H22N2O4
Molecular Weight282.34 g/mol
Exact Mass282.16
IUPAC Name2-(butan-2-ylamino)acetic acid;3-pyridin-3-ylpropanoic acid
SMILESCCC(C)NCC(=O)O.O=C(O)CCc1cccnc1
InChIInChI=1S/C8H9NO2.C6H13NO2/c10-8(11)4-3-7-2-1-5-9-6-7;1-3-5(2)7-4-6(8)9/h1-2,5-6H,3-4H2,(H,10,11);5,7H,3-4H2,1-2H3,(H,8,9)
InChIKeyFUXNMKNUJMETFQ-UHFFFAOYSA-N
XLogP1.56
TPSA99.52 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500282.34
LogP ≤ 51.56
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 2-(butan-2-ylamino)acetic acid;3-pyridin-3-ylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(butan-2-ylamino)acetic acid;3-pyridin-3-ylpropanoic acid?
The IUPAC name of 2-(butan-2-ylamino)acetic acid;3-pyridin-3-ylpropanoic acid (CID 67301169) is 2-(butan-2-ylamino)acetic acid;3-pyridin-3-ylpropanoic acid.
What is the SMILES notation for 2-(butan-2-ylamino)acetic acid;3-pyridin-3-ylpropanoic acid?
The canonical SMILES for 2-(butan-2-ylamino)acetic acid;3-pyridin-3-ylpropanoic acid is CCC(C)NCC(=O)O.O=C(O)CCc1cccnc1.
What is the InChIKey of 2-(butan-2-ylamino)acetic acid;3-pyridin-3-ylpropanoic acid?
The InChIKey is FUXNMKNUJMETFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2.C6H13NO2/c10-8(11)4-3-7-2-1-5-9-6-7;1-3-5(2)7-4-6(8)9/h1-2,5-6H,3-4H2,(H,10,11);5,7H,3-4H2,1-2H3,(H,8,9).
What are the key properties of 2-(butan-2-ylamino)acetic acid;3-pyridin-3-ylpropanoic acid?
2-(butan-2-ylamino)acetic acid;3-pyridin-3-ylpropanoic acid has a molecular weight of 282.34 g/mol, XLogP of 1.56, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(butan-2-ylamino)acetic acid;3-pyridin-3-ylpropanoic acid is sourced from PubChem (CID 67301169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).