C14H22N2O4 — CID 67301169
2-(butan-2-ylamino)acetic acid;3-pyridin-3-ylpropanoic acid (PubChem CID 67301169) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is 2-(butan-2-ylamino)acetic acid;3-pyridin-3-ylpropanoic acid.
| Compound Name | 2-(butan-2-ylamino)acetic acid;3-pyridin-3-ylpropanoic acid |
|---|---|
| PubChem CID | 67301169 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 2-(butan-2-ylamino)acetic acid;3-pyridin-3-ylpropanoic acid |
| SMILES | CCC(C)NCC(=O)O.O=C(O)CCc1cccnc1 |
| InChI | InChI=1S/C8H9NO2.C6H13NO2/c10-8(11)4-3-7-2-1-5-9-6-7;1-3-5(2)7-4-6(8)9/h1-2,5-6H,3-4H2,(H,10,11);5,7H,3-4H2,1-2H3,(H,8,9) |
| InChIKey | FUXNMKNUJMETFQ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |