C13H17NO2 — CID 159181392
6-methyl-1-pyridin-3-ylheptane-3,5-dione (PubChem CID 159181392) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 6-methyl-1-pyridin-3-ylheptane-3,5-dione.
| Compound Name | 6-methyl-1-pyridin-3-ylheptane-3,5-dione |
|---|---|
| PubChem CID | 159181392 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 6-methyl-1-pyridin-3-ylheptane-3,5-dione |
| SMILES | CC(C)C(=O)CC(=O)CCc1cccnc1 |
| InChI | InChI=1S/C13H17NO2/c1-10(2)13(16)8-12(15)6-5-11-4-3-7-14-9-11/h3-4,7,9-10H,5-6,8H2,1-2H3 |
| InChIKey | KMYBAAPHSQYFHN-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|