C17H19NO — CID 105081292
1-(3,5-dimethylphenyl)-4-pyridin-3-ylbutan-2-one (PubChem CID 105081292) has the molecular formula C17H19NO and a molecular weight of 253.34 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-4-pyridin-3-ylbutan-2-one.
| Compound Name | 1-(3,5-dimethylphenyl)-4-pyridin-3-ylbutan-2-one |
|---|---|
| PubChem CID | 105081292 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-4-pyridin-3-ylbutan-2-one |
| SMILES | Cc1cc(C)cc(CC(=O)CCc2cccnc2)c1 |
| InChI | InChI=1S/C17H19NO/c1-13-8-14(2)10-16(9-13)11-17(19)6-5-15-4-3-7-18-12-15/h3-4,7-10,12H,5-6,11H2,1-2H3 |
| InChIKey | GUNWZUDPRFYKDQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |