C27H29NO2 — CID 159913920
1-[4-[2-(4-tert-butylphenyl)acetyl]phenyl]-4-pyridin-3-ylbutan-2-one (PubChem CID 159913920) has the molecular formula C27H29NO2 and a molecular weight of 399.53 g/mol. Its IUPAC name is 1-[4-[2-(4-tert-butylphenyl)acetyl]phenyl]-4-pyridin-3-ylbutan-2-one.
| Compound Name | 1-[4-[2-(4-tert-butylphenyl)acetyl]phenyl]-4-pyridin-3-ylbutan-2-one |
|---|---|
| PubChem CID | 159913920 |
| Molecular Formula | C27H29NO2 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | 1-[4-[2-(4-tert-butylphenyl)acetyl]phenyl]-4-pyridin-3-ylbutan-2-one |
| SMILES | CC(C)(C)c1ccc(CC(=O)c2ccc(CC(=O)CCc3cccnc3)cc2)cc1 |
| InChI | InChI=1S/C27H29NO2/c1-27(2,3)24-13-8-21(9-14-24)18-26(30)23-11-6-20(7-12-23)17-25(29)15-10-22-5-4-16-28-19-22/h4-9,11-14,16,19H,10,15,17-18H2,1-3H3 |
| InChIKey | NXNNUMAJLDBCRD-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |