C15H13ClFNO — CID 103042840
1-(3-chloro-4-fluorophenyl)-4-pyridin-3-ylbutan-2-one (PubChem CID 103042840) has the molecular formula C15H13ClFNO and a molecular weight of 277.73 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-4-pyridin-3-ylbutan-2-one.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-4-pyridin-3-ylbutan-2-one |
|---|---|
| PubChem CID | 103042840 |
| Molecular Formula | C15H13ClFNO |
| Molecular Weight | 277.73 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-4-pyridin-3-ylbutan-2-one |
| SMILES | O=C(CCc1cccnc1)Cc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C15H13ClFNO/c16-14-9-12(4-6-15(14)17)8-13(19)5-3-11-2-1-7-18-10-11/h1-2,4,6-7,9-10H,3,5,8H2 |
| InChIKey | UALSOPWDFGCWNA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.73 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |