C14H11Cl2NO — CID 55096177
1-(3,4-dichlorophenyl)-3-pyridin-3-ylpropan-2-one (PubChem CID 55096177) has the molecular formula C14H11Cl2NO and a molecular weight of 280.15 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-pyridin-3-ylpropan-2-one.
| Compound Name | 1-(3,4-dichlorophenyl)-3-pyridin-3-ylpropan-2-one |
|---|---|
| PubChem CID | 55096177 |
| Molecular Formula | C14H11Cl2NO |
| Molecular Weight | 280.15 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-pyridin-3-ylpropan-2-one |
| SMILES | O=C(Cc1cccnc1)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H11Cl2NO/c15-13-4-3-10(8-14(13)16)6-12(18)7-11-2-1-5-17-9-11/h1-5,8-9H,6-7H2 |
| InChIKey | FDXPJFGPQXWPBQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.15 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |