C16H15Cl2NO — CID 116595878
1-[2-(aminomethyl)phenyl]-3-(3,4-dichlorophenyl)propan-2-one (PubChem CID 116595878) has the molecular formula C16H15Cl2NO and a molecular weight of 308.21 g/mol. Its IUPAC name is 1-[2-(aminomethyl)phenyl]-3-(3,4-dichlorophenyl)propan-2-one.
| Compound Name | 1-[2-(aminomethyl)phenyl]-3-(3,4-dichlorophenyl)propan-2-one |
|---|---|
| PubChem CID | 116595878 |
| Molecular Formula | C16H15Cl2NO |
| Molecular Weight | 308.21 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 1-[2-(aminomethyl)phenyl]-3-(3,4-dichlorophenyl)propan-2-one |
| SMILES | NCc1ccccc1CC(=O)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H15Cl2NO/c17-15-6-5-11(8-16(15)18)7-14(20)9-12-3-1-2-4-13(12)10-19/h1-6,8H,7,9-10,19H2 |
| InChIKey | DPHLDGUIEKXMEB-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.21 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |