C13H10Cl2OS — CID 62621958
1-(3,4-dichlorophenyl)-3-thiophen-2-ylpropan-2-one (PubChem CID 62621958) has the molecular formula C13H10Cl2OS and a molecular weight of 285.19 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-thiophen-2-ylpropan-2-one.
| Compound Name | 1-(3,4-dichlorophenyl)-3-thiophen-2-ylpropan-2-one |
|---|---|
| PubChem CID | 62621958 |
| Molecular Formula | C13H10Cl2OS |
| Molecular Weight | 285.19 g/mol |
| Exact Mass | 283.98 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-thiophen-2-ylpropan-2-one |
| SMILES | O=C(Cc1ccc(Cl)c(Cl)c1)Cc1cccs1 |
| InChI | InChI=1S/C13H10Cl2OS/c14-12-4-3-9(7-13(12)15)6-10(16)8-11-2-1-5-17-11/h1-5,7H,6,8H2 |
| InChIKey | XMSGDVOOKMFFPQ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.19 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |