C15H16Cl2OS — CID 63520188
1-(3,4-dichlorophenyl)-5-thiophen-2-ylpentan-2-ol (PubChem CID 63520188) has the molecular formula C15H16Cl2OS and a molecular weight of 315.27 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-5-thiophen-2-ylpentan-2-ol.
| Compound Name | 1-(3,4-dichlorophenyl)-5-thiophen-2-ylpentan-2-ol |
|---|---|
| PubChem CID | 63520188 |
| Molecular Formula | C15H16Cl2OS |
| Molecular Weight | 315.27 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-5-thiophen-2-ylpentan-2-ol |
| SMILES | OC(CCCc1cccs1)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H16Cl2OS/c16-14-7-6-11(10-15(14)17)9-12(18)3-1-4-13-5-2-8-19-13/h2,5-8,10,12,18H,1,3-4,9H2 |
| InChIKey | DAKJQGVIAMNDAU-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.27 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |