C16H19Cl2NS — CID 63527812
1-(3,4-dichlorophenyl)-N-methyl-5-thiophen-2-ylpentan-2-amine (PubChem CID 63527812) has the molecular formula C16H19Cl2NS and a molecular weight of 328.31 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-N-methyl-5-thiophen-2-ylpentan-2-amine.
| Compound Name | 1-(3,4-dichlorophenyl)-N-methyl-5-thiophen-2-ylpentan-2-amine |
|---|---|
| PubChem CID | 63527812 |
| Molecular Formula | C16H19Cl2NS |
| Molecular Weight | 328.31 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-N-methyl-5-thiophen-2-ylpentan-2-amine |
| SMILES | CNC(CCCc1cccs1)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H19Cl2NS/c1-19-13(4-2-5-14-6-3-9-20-14)10-12-7-8-15(17)16(18)11-12/h3,6-9,11,13,19H,2,4-5,10H2,1H3 |
| InChIKey | XICOPAUHTBSOHR-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.31 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |