C15H16ClFOS — CID 107894455
1-(4-chloro-3-fluorophenyl)-5-thiophen-2-ylpentan-2-ol (PubChem CID 107894455) has the molecular formula C15H16ClFOS and a molecular weight of 298.81 g/mol. Its IUPAC name is 1-(4-chloro-3-fluorophenyl)-5-thiophen-2-ylpentan-2-ol.
| Compound Name | 1-(4-chloro-3-fluorophenyl)-5-thiophen-2-ylpentan-2-ol |
|---|---|
| PubChem CID | 107894455 |
| Molecular Formula | C15H16ClFOS |
| Molecular Weight | 298.81 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 1-(4-chloro-3-fluorophenyl)-5-thiophen-2-ylpentan-2-ol |
| SMILES | OC(CCCc1cccs1)Cc1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C15H16ClFOS/c16-14-7-6-11(10-15(14)17)9-12(18)3-1-4-13-5-2-8-19-13/h2,5-8,10,12,18H,1,3-4,9H2 |
| InChIKey | AAKAXXRGJOMXCO-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.81 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |