C16H19ClFNS — CID 105178932
1-(2-chloro-3-fluorophenyl)-N-methyl-5-thiophen-2-ylpentan-2-amine (PubChem CID 105178932) has the molecular formula C16H19ClFNS and a molecular weight of 311.85 g/mol. Its IUPAC name is 1-(2-chloro-3-fluorophenyl)-N-methyl-5-thiophen-2-ylpentan-2-amine.
| Compound Name | 1-(2-chloro-3-fluorophenyl)-N-methyl-5-thiophen-2-ylpentan-2-amine |
|---|---|
| PubChem CID | 105178932 |
| Molecular Formula | C16H19ClFNS |
| Molecular Weight | 311.85 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 1-(2-chloro-3-fluorophenyl)-N-methyl-5-thiophen-2-ylpentan-2-amine |
| SMILES | CNC(CCCc1cccs1)Cc1cccc(F)c1Cl |
| InChI | InChI=1S/C16H19ClFNS/c1-19-13(6-3-7-14-8-4-10-20-14)11-12-5-2-9-15(18)16(12)17/h2,4-5,8-10,13,19H,3,6-7,11H2,1H3 |
| InChIKey | ANMSPDHFBSQZIT-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.85 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |