C16H18BrF2NS — CID 106274231
1-(3-bromo-2,6-difluorophenyl)-N-methyl-5-thiophen-2-ylpentan-2-amine (PubChem CID 106274231) has the molecular formula C16H18BrF2NS and a molecular weight of 374.29 g/mol. Its IUPAC name is 1-(3-bromo-2,6-difluorophenyl)-N-methyl-5-thiophen-2-ylpentan-2-amine.
| Compound Name | 1-(3-bromo-2,6-difluorophenyl)-N-methyl-5-thiophen-2-ylpentan-2-amine |
|---|---|
| PubChem CID | 106274231 |
| Molecular Formula | C16H18BrF2NS |
| Molecular Weight | 374.29 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | 1-(3-bromo-2,6-difluorophenyl)-N-methyl-5-thiophen-2-ylpentan-2-amine |
| SMILES | CNC(CCCc1cccs1)Cc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C16H18BrF2NS/c1-20-11(4-2-5-12-6-3-9-21-12)10-13-15(18)8-7-14(17)16(13)19/h3,6-9,11,20H,2,4-5,10H2,1H3 |
| InChIKey | WLPWXOJAQMYDEM-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.29 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|