C13H16BrF4NO — CID 106268855
1-(3-bromo-2,6-difluorophenyl)-4-(2,2-difluoroethoxy)-N-methylbutan-2-amine (PubChem CID 106268855) has the molecular formula C13H16BrF4NO and a molecular weight of 358.17 g/mol. Its IUPAC name is 1-(3-bromo-2,6-difluorophenyl)-4-(2,2-difluoroethoxy)-N-methylbutan-2-amine.
| Compound Name | 1-(3-bromo-2,6-difluorophenyl)-4-(2,2-difluoroethoxy)-N-methylbutan-2-amine |
|---|---|
| PubChem CID | 106268855 |
| Molecular Formula | C13H16BrF4NO |
| Molecular Weight | 358.17 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 1-(3-bromo-2,6-difluorophenyl)-4-(2,2-difluoroethoxy)-N-methylbutan-2-amine |
| SMILES | CNC(CCOCC(F)F)Cc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C13H16BrF4NO/c1-19-8(4-5-20-7-12(16)17)6-9-11(15)3-2-10(14)13(9)18/h2-3,8,12,19H,4-7H2,1H3 |
| InChIKey | LAUPBOSZZJRUAD-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.17 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|