C14H20BrF2NO — CID 106273617
1-(3-bromo-2,6-difluorophenyl)-5-ethoxy-N-methylpentan-2-amine (PubChem CID 106273617) has the molecular formula C14H20BrF2NO and a molecular weight of 336.22 g/mol. Its IUPAC name is 1-(3-bromo-2,6-difluorophenyl)-5-ethoxy-N-methylpentan-2-amine.
| Compound Name | 1-(3-bromo-2,6-difluorophenyl)-5-ethoxy-N-methylpentan-2-amine |
|---|---|
| PubChem CID | 106273617 |
| Molecular Formula | C14H20BrF2NO |
| Molecular Weight | 336.22 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 1-(3-bromo-2,6-difluorophenyl)-5-ethoxy-N-methylpentan-2-amine |
| SMILES | CCOCCCC(Cc1c(F)ccc(Br)c1F)NC |
| InChI | InChI=1S/C14H20BrF2NO/c1-3-19-8-4-5-10(18-2)9-11-13(16)7-6-12(15)14(11)17/h6-7,10,18H,3-5,8-9H2,1-2H3 |
| InChIKey | XEPLGKJQTHVCFC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.22 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|