C11H14BrClF2N2 — CID 106271023
[1-(3-bromo-2,6-difluorophenyl)-5-chloropentan-2-yl]hydrazine (PubChem CID 106271023) has the molecular formula C11H14BrClF2N2 and a molecular weight of 327.60 g/mol. Its IUPAC name is [1-(3-bromo-2,6-difluorophenyl)-5-chloropentan-2-yl]hydrazine.
| Compound Name | [1-(3-bromo-2,6-difluorophenyl)-5-chloropentan-2-yl]hydrazine |
|---|---|
| PubChem CID | 106271023 |
| Molecular Formula | C11H14BrClF2N2 |
| Molecular Weight | 327.60 g/mol |
| Exact Mass | 326.00 |
| IUPAC Name | [1-(3-bromo-2,6-difluorophenyl)-5-chloropentan-2-yl]hydrazine |
| SMILES | NNC(CCCCl)Cc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C11H14BrClF2N2/c12-9-3-4-10(14)8(11(9)15)6-7(17-16)2-1-5-13/h3-4,7,17H,1-2,5-6,16H2 |
| InChIKey | FVQFTHUVDNCNJQ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.60 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|