C11H15BrF2N2O2 — CID 106271065
[3-(3-bromo-2,6-difluorophenyl)-1,1-dimethoxypropan-2-yl]hydrazine (PubChem CID 106271065) has the molecular formula C11H15BrF2N2O2 and a molecular weight of 325.15 g/mol. Its IUPAC name is [3-(3-bromo-2,6-difluorophenyl)-1,1-dimethoxypropan-2-yl]hydrazine.
| Compound Name | [3-(3-bromo-2,6-difluorophenyl)-1,1-dimethoxypropan-2-yl]hydrazine |
|---|---|
| PubChem CID | 106271065 |
| Molecular Formula | C11H15BrF2N2O2 |
| Molecular Weight | 325.15 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | [3-(3-bromo-2,6-difluorophenyl)-1,1-dimethoxypropan-2-yl]hydrazine |
| SMILES | COC(OC)C(Cc1c(F)ccc(Br)c1F)NN |
| InChI | InChI=1S/C11H15BrF2N2O2/c1-17-11(18-2)9(16-15)5-6-8(13)4-3-7(12)10(6)14/h3-4,9,11,16H,5,15H2,1-2H3 |
| InChIKey | BRVKHOSYKLMNNX-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.15 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|