C11H15BrClFN2 — CID 105235622
[1-(5-bromo-2-fluorophenyl)-5-chloropentan-2-yl]hydrazine (PubChem CID 105235622) has the molecular formula C11H15BrClFN2 and a molecular weight of 309.61 g/mol. Its IUPAC name is [1-(5-bromo-2-fluorophenyl)-5-chloropentan-2-yl]hydrazine.
| Compound Name | [1-(5-bromo-2-fluorophenyl)-5-chloropentan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105235622 |
| Molecular Formula | C11H15BrClFN2 |
| Molecular Weight | 309.61 g/mol |
| Exact Mass | 308.01 |
| IUPAC Name | [1-(5-bromo-2-fluorophenyl)-5-chloropentan-2-yl]hydrazine |
| SMILES | NNC(CCCCl)Cc1cc(Br)ccc1F |
| InChI | InChI=1S/C11H15BrClFN2/c12-9-3-4-11(14)8(6-9)7-10(16-15)2-1-5-13/h3-4,6,10,16H,1-2,5,7,15H2 |
| InChIKey | VYLJCHYOTUBJCP-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.61 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|