C11H14BrF2N — CID 106273281
4-(3-bromo-2,6-difluorophenyl)-3-methylbutan-1-amine (PubChem CID 106273281) has the molecular formula C11H14BrF2N and a molecular weight of 278.14 g/mol. Its IUPAC name is 4-(3-bromo-2,6-difluorophenyl)-3-methylbutan-1-amine.
| Compound Name | 4-(3-bromo-2,6-difluorophenyl)-3-methylbutan-1-amine |
|---|---|
| PubChem CID | 106273281 |
| Molecular Formula | C11H14BrF2N |
| Molecular Weight | 278.14 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | 4-(3-bromo-2,6-difluorophenyl)-3-methylbutan-1-amine |
| SMILES | CC(CCN)Cc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C11H14BrF2N/c1-7(4-5-15)6-8-10(13)3-2-9(12)11(8)14/h2-3,7H,4-6,15H2,1H3 |
| InChIKey | ZQBHLBZIRMBJEW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.14 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|