C14H20BrF2N — CID 106274291
1-(3-bromo-2,6-difluorophenyl)octan-2-amine (PubChem CID 106274291) has the molecular formula C14H20BrF2N and a molecular weight of 320.22 g/mol. Its IUPAC name is 1-(3-bromo-2,6-difluorophenyl)octan-2-amine.
| Compound Name | 1-(3-bromo-2,6-difluorophenyl)octan-2-amine |
|---|---|
| PubChem CID | 106274291 |
| Molecular Formula | C14H20BrF2N |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 1-(3-bromo-2,6-difluorophenyl)octan-2-amine |
| SMILES | CCCCCCC(N)Cc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C14H20BrF2N/c1-2-3-4-5-6-10(18)9-11-13(16)8-7-12(15)14(11)17/h7-8,10H,2-6,9,18H2,1H3 |
| InChIKey | ZOLASRBXVCQZGQ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|