C13H18BrF2NO — CID 106268510
1-(3-bromo-2,6-difluorophenyl)-3-methoxyhexan-2-amine (PubChem CID 106268510) has the molecular formula C13H18BrF2NO and a molecular weight of 322.19 g/mol. Its IUPAC name is 1-(3-bromo-2,6-difluorophenyl)-3-methoxyhexan-2-amine.
| Compound Name | 1-(3-bromo-2,6-difluorophenyl)-3-methoxyhexan-2-amine |
|---|---|
| PubChem CID | 106268510 |
| Molecular Formula | C13H18BrF2NO |
| Molecular Weight | 322.19 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 1-(3-bromo-2,6-difluorophenyl)-3-methoxyhexan-2-amine |
| SMILES | CCCC(OC)C(N)Cc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C13H18BrF2NO/c1-3-4-12(18-2)11(17)7-8-10(15)6-5-9(14)13(8)16/h5-6,11-12H,3-4,7,17H2,1-2H3 |
| InChIKey | XMJQSLFUMKLGRD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.19 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|