C10H12BrF2N — CID 106943489
4-(3-bromo-2,6-difluorophenyl)butan-2-amine (PubChem CID 106943489) has the molecular formula C10H12BrF2N and a molecular weight of 264.11 g/mol. Its IUPAC name is 4-(3-bromo-2,6-difluorophenyl)butan-2-amine.
| Compound Name | 4-(3-bromo-2,6-difluorophenyl)butan-2-amine |
|---|---|
| PubChem CID | 106943489 |
| Molecular Formula | C10H12BrF2N |
| Molecular Weight | 264.11 g/mol |
| Exact Mass | 263.01 |
| IUPAC Name | 4-(3-bromo-2,6-difluorophenyl)butan-2-amine |
| SMILES | CC(N)CCc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C10H12BrF2N/c1-6(14)2-3-7-9(12)5-4-8(11)10(7)13/h4-6H,2-3,14H2,1H3 |
| InChIKey | ULSBPDQUAKTTGS-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.11 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|