C10H12BrF2NS — CID 106264259
2-[(3-bromo-2,6-difluorophenyl)methylsulfanyl]propan-1-amine (PubChem CID 106264259) has the molecular formula C10H12BrF2NS and a molecular weight of 296.18 g/mol. Its IUPAC name is 2-[(3-bromo-2,6-difluorophenyl)methylsulfanyl]propan-1-amine.
| Compound Name | 2-[(3-bromo-2,6-difluorophenyl)methylsulfanyl]propan-1-amine |
|---|---|
| PubChem CID | 106264259 |
| Molecular Formula | C10H12BrF2NS |
| Molecular Weight | 296.18 g/mol |
| Exact Mass | 294.98 |
| IUPAC Name | 2-[(3-bromo-2,6-difluorophenyl)methylsulfanyl]propan-1-amine |
| SMILES | CC(CN)SCc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C10H12BrF2NS/c1-6(4-14)15-5-7-9(12)3-2-8(11)10(7)13/h2-3,6H,4-5,14H2,1H3 |
| InChIKey | PHMJZIJTTQHMFW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.18 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|