C10H12BrF2NO — CID 106272227
2-(aminomethyl)-3-(3-bromo-2,6-difluorophenyl)propan-1-ol (PubChem CID 106272227) has the molecular formula C10H12BrF2NO and a molecular weight of 280.11 g/mol. Its IUPAC name is 2-(aminomethyl)-3-(3-bromo-2,6-difluorophenyl)propan-1-ol.
| Compound Name | 2-(aminomethyl)-3-(3-bromo-2,6-difluorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 106272227 |
| Molecular Formula | C10H12BrF2NO |
| Molecular Weight | 280.11 g/mol |
| Exact Mass | 279.01 |
| IUPAC Name | 2-(aminomethyl)-3-(3-bromo-2,6-difluorophenyl)propan-1-ol |
| SMILES | NCC(CO)Cc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C10H12BrF2NO/c11-8-1-2-9(12)7(10(8)13)3-6(4-14)5-15/h1-2,6,15H,3-5,14H2 |
| InChIKey | VMCPDFODLLIVBF-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.11 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|