C15H11BrF4O — CID 106274453
1-(3-bromo-2,6-difluorophenyl)-3-(2,3-difluorophenyl)propan-2-ol (PubChem CID 106274453) has the molecular formula C15H11BrF4O and a molecular weight of 363.15 g/mol. Its IUPAC name is 1-(3-bromo-2,6-difluorophenyl)-3-(2,3-difluorophenyl)propan-2-ol.
| Compound Name | 1-(3-bromo-2,6-difluorophenyl)-3-(2,3-difluorophenyl)propan-2-ol |
|---|---|
| PubChem CID | 106274453 |
| Molecular Formula | C15H11BrF4O |
| Molecular Weight | 363.15 g/mol |
| Exact Mass | 361.99 |
| IUPAC Name | 1-(3-bromo-2,6-difluorophenyl)-3-(2,3-difluorophenyl)propan-2-ol |
| SMILES | OC(Cc1cccc(F)c1F)Cc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C15H11BrF4O/c16-11-4-5-12(17)10(15(11)20)7-9(21)6-8-2-1-3-13(18)14(8)19/h1-5,9,21H,6-7H2 |
| InChIKey | CTHOKDHNRGAPRC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.15 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|