C15H12BrClF2O — CID 106266378
1-(3-bromo-2,6-difluorophenyl)-3-(3-chlorophenyl)propan-2-ol (PubChem CID 106266378) has the molecular formula C15H12BrClF2O and a molecular weight of 361.61 g/mol. Its IUPAC name is 1-(3-bromo-2,6-difluorophenyl)-3-(3-chlorophenyl)propan-2-ol.
| Compound Name | 1-(3-bromo-2,6-difluorophenyl)-3-(3-chlorophenyl)propan-2-ol |
|---|---|
| PubChem CID | 106266378 |
| Molecular Formula | C15H12BrClF2O |
| Molecular Weight | 361.61 g/mol |
| Exact Mass | 359.97 |
| IUPAC Name | 1-(3-bromo-2,6-difluorophenyl)-3-(3-chlorophenyl)propan-2-ol |
| SMILES | OC(Cc1cccc(Cl)c1)Cc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C15H12BrClF2O/c16-13-4-5-14(18)12(15(13)19)8-11(20)7-9-2-1-3-10(17)6-9/h1-6,11,20H,7-8H2 |
| InChIKey | JSSITMVDVACKJV-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.61 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|