C15H13BrClF2N — CID 106271721
3-(3-bromo-2,6-difluorophenyl)-2-(3-chlorophenyl)propan-1-amine (PubChem CID 106271721) has the molecular formula C15H13BrClF2N and a molecular weight of 360.63 g/mol. Its IUPAC name is 3-(3-bromo-2,6-difluorophenyl)-2-(3-chlorophenyl)propan-1-amine.
| Compound Name | 3-(3-bromo-2,6-difluorophenyl)-2-(3-chlorophenyl)propan-1-amine |
|---|---|
| PubChem CID | 106271721 |
| Molecular Formula | C15H13BrClF2N |
| Molecular Weight | 360.63 g/mol |
| Exact Mass | 358.99 |
| IUPAC Name | 3-(3-bromo-2,6-difluorophenyl)-2-(3-chlorophenyl)propan-1-amine |
| SMILES | NCC(Cc1c(F)ccc(Br)c1F)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H13BrClF2N/c16-13-4-5-14(18)12(15(13)19)7-10(8-20)9-2-1-3-11(17)6-9/h1-6,10H,7-8,20H2 |
| InChIKey | SKXSAMZAOHUCEW-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.63 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|