C15H11BrClF3 — CID 106273849
1-bromo-3-[3-chloro-2-(3-fluorophenyl)propyl]-2,4-difluorobenzene (PubChem CID 106273849) has the molecular formula C15H11BrClF3 and a molecular weight of 363.60 g/mol. Its IUPAC name is 1-bromo-3-[3-chloro-2-(3-fluorophenyl)propyl]-2,4-difluorobenzene.
| Compound Name | 1-bromo-3-[3-chloro-2-(3-fluorophenyl)propyl]-2,4-difluorobenzene |
|---|---|
| PubChem CID | 106273849 |
| Molecular Formula | C15H11BrClF3 |
| Molecular Weight | 363.60 g/mol |
| Exact Mass | 361.97 |
| IUPAC Name | 1-bromo-3-[3-chloro-2-(3-fluorophenyl)propyl]-2,4-difluorobenzene |
| SMILES | Fc1cccc(C(CCl)Cc2c(F)ccc(Br)c2F)c1 |
| InChI | InChI=1S/C15H11BrClF3/c16-13-4-5-14(19)12(15(13)20)7-10(8-17)9-2-1-3-11(18)6-9/h1-6,10H,7-8H2 |
| InChIKey | FWURLLSXTPIGOF-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.60 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|