C15H11BrCl2F2 — CID 106273850
1-bromo-3-[3-chloro-2-(3-chlorophenyl)propyl]-2,4-difluorobenzene (PubChem CID 106273850) has the molecular formula C15H11BrCl2F2 and a molecular weight of 380.06 g/mol. Its IUPAC name is 1-bromo-3-[3-chloro-2-(3-chlorophenyl)propyl]-2,4-difluorobenzene.
| Compound Name | 1-bromo-3-[3-chloro-2-(3-chlorophenyl)propyl]-2,4-difluorobenzene |
|---|---|
| PubChem CID | 106273850 |
| Molecular Formula | C15H11BrCl2F2 |
| Molecular Weight | 380.06 g/mol |
| Exact Mass | 377.94 |
| IUPAC Name | 1-bromo-3-[3-chloro-2-(3-chlorophenyl)propyl]-2,4-difluorobenzene |
| SMILES | Fc1ccc(Br)c(F)c1CC(CCl)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H11BrCl2F2/c16-13-4-5-14(19)12(15(13)20)7-10(8-17)9-2-1-3-11(18)6-9/h1-6,10H,7-8H2 |
| InChIKey | SUJQKTRUWARBOG-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.06 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|