C15H13BrF2O — CID 106265334
1-(3-bromo-2,6-difluorophenyl)-3-phenylpropan-2-ol (PubChem CID 106265334) has the molecular formula C15H13BrF2O and a molecular weight of 327.17 g/mol. Its IUPAC name is 1-(3-bromo-2,6-difluorophenyl)-3-phenylpropan-2-ol.
| Compound Name | 1-(3-bromo-2,6-difluorophenyl)-3-phenylpropan-2-ol |
|---|---|
| PubChem CID | 106265334 |
| Molecular Formula | C15H13BrF2O |
| Molecular Weight | 327.17 g/mol |
| Exact Mass | 326.01 |
| IUPAC Name | 1-(3-bromo-2,6-difluorophenyl)-3-phenylpropan-2-ol |
| SMILES | OC(Cc1ccccc1)Cc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C15H13BrF2O/c16-13-6-7-14(17)12(15(13)18)9-11(19)8-10-4-2-1-3-5-10/h1-7,11,19H,8-9H2 |
| InChIKey | ADBGNKACFYFTJR-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.17 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|