C15H14BrF2NO2 — CID 106266545
1-(3-bromo-2,6-difluorophenyl)-3-(6-methoxy-3-pyridinyl)propan-2-ol (PubChem CID 106266545) has the molecular formula C15H14BrF2NO2 and a molecular weight of 358.18 g/mol. Its IUPAC name is 1-(3-bromo-2,6-difluorophenyl)-3-(6-methoxy-3-pyridinyl)propan-2-ol.
| Compound Name | 1-(3-bromo-2,6-difluorophenyl)-3-(6-methoxy-3-pyridinyl)propan-2-ol |
|---|---|
| PubChem CID | 106266545 |
| Molecular Formula | C15H14BrF2NO2 |
| Molecular Weight | 358.18 g/mol |
| Exact Mass | 357.02 |
| IUPAC Name | 1-(3-bromo-2,6-difluorophenyl)-3-(6-methoxy-3-pyridinyl)propan-2-ol |
| SMILES | COc1ccc(CC(O)Cc2c(F)ccc(Br)c2F)cn1 |
| InChI | InChI=1S/C15H14BrF2NO2/c1-21-14-5-2-9(8-19-14)6-10(20)7-11-13(17)4-3-12(16)15(11)18/h2-5,8,10,20H,6-7H2,1H3 |
| InChIKey | GZUPUMJBCRHPGZ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.18 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|