C12H16BrF2NO2 — CID 106273651
1-(3-bromo-2,6-difluorophenyl)-3-(2-methoxyethylamino)propan-2-ol (PubChem CID 106273651) has the molecular formula C12H16BrF2NO2 and a molecular weight of 324.17 g/mol. Its IUPAC name is 1-(3-bromo-2,6-difluorophenyl)-3-(2-methoxyethylamino)propan-2-ol.
| Compound Name | 1-(3-bromo-2,6-difluorophenyl)-3-(2-methoxyethylamino)propan-2-ol |
|---|---|
| PubChem CID | 106273651 |
| Molecular Formula | C12H16BrF2NO2 |
| Molecular Weight | 324.17 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | 1-(3-bromo-2,6-difluorophenyl)-3-(2-methoxyethylamino)propan-2-ol |
| SMILES | COCCNCC(O)Cc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C12H16BrF2NO2/c1-18-5-4-16-7-8(17)6-9-11(14)3-2-10(13)12(9)15/h2-3,8,16-17H,4-7H2,1H3 |
| InChIKey | ZEBPRYYEEWVOEP-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.17 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|