C12H17F2NO2S — CID 113317862
1-(2,5-difluorophenyl)sulfanyl-3-(2-methoxyethylamino)propan-2-ol (PubChem CID 113317862) has the molecular formula C12H17F2NO2S and a molecular weight of 277.34 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)sulfanyl-3-(2-methoxyethylamino)propan-2-ol.
| Compound Name | 1-(2,5-difluorophenyl)sulfanyl-3-(2-methoxyethylamino)propan-2-ol |
|---|---|
| PubChem CID | 113317862 |
| Molecular Formula | C12H17F2NO2S |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 1-(2,5-difluorophenyl)sulfanyl-3-(2-methoxyethylamino)propan-2-ol |
| SMILES | COCCNCC(O)CSc1cc(F)ccc1F |
| InChI | InChI=1S/C12H17F2NO2S/c1-17-5-4-15-7-10(16)8-18-12-6-9(13)2-3-11(12)14/h2-3,6,10,15-16H,4-5,7-8H2,1H3 |
| InChIKey | ONYKOCSWLHPDCP-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|