C13H17FO5S — CID 106988391
4-fluoro-3-[2-hydroxy-3-(2-methoxyethoxy)propyl]sulfanylbenzoic acid (PubChem CID 106988391) has the molecular formula C13H17FO5S and a molecular weight of 304.34 g/mol. Its IUPAC name is 4-fluoro-3-[2-hydroxy-3-(2-methoxyethoxy)propyl]sulfanylbenzoic acid.
| Compound Name | 4-fluoro-3-[2-hydroxy-3-(2-methoxyethoxy)propyl]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 106988391 |
| Molecular Formula | C13H17FO5S |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 4-fluoro-3-[2-hydroxy-3-(2-methoxyethoxy)propyl]sulfanylbenzoic acid |
| SMILES | COCCOCC(O)CSc1cc(C(=O)O)ccc1F |
| InChI | InChI=1S/C13H17FO5S/c1-18-4-5-19-7-10(15)8-20-12-6-9(13(16)17)2-3-11(12)14/h2-3,6,10,15H,4-5,7-8H2,1H3,(H,16,17) |
| InChIKey | OQNKTXKESPMRDW-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|