C10H11FO4S — CID 79672426
4-(2,3-dihydroxypropylsulfanyl)-3-fluorobenzoic acid (PubChem CID 79672426) has the molecular formula C10H11FO4S and a molecular weight of 246.26 g/mol. Its IUPAC name is 4-(2,3-dihydroxypropylsulfanyl)-3-fluorobenzoic acid.
| Compound Name | 4-(2,3-dihydroxypropylsulfanyl)-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 79672426 |
| Molecular Formula | C10H11FO4S |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | 4-(2,3-dihydroxypropylsulfanyl)-3-fluorobenzoic acid |
| SMILES | O=C(O)c1ccc(SCC(O)CO)c(F)c1 |
| InChI | InChI=1S/C10H11FO4S/c11-8-3-6(10(14)15)1-2-9(8)16-5-7(13)4-12/h1-3,7,12-13H,4-5H2,(H,14,15) |
| InChIKey | BPFKZKAQFFFHMX-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |