C10H11FO6S — CID 82850938
3-(2,3-dihydroxypropylsulfonyl)-4-fluorobenzoic acid (PubChem CID 82850938) has the molecular formula C10H11FO6S and a molecular weight of 278.26 g/mol. Its IUPAC name is 3-(2,3-dihydroxypropylsulfonyl)-4-fluorobenzoic acid.
| Compound Name | 3-(2,3-dihydroxypropylsulfonyl)-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 82850938 |
| Molecular Formula | C10H11FO6S |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 3-(2,3-dihydroxypropylsulfonyl)-4-fluorobenzoic acid |
| SMILES | O=C(O)c1ccc(F)c(S(=O)(=O)CC(O)CO)c1 |
| InChI | InChI=1S/C10H11FO6S/c11-8-2-1-6(10(14)15)3-9(8)18(16,17)5-7(13)4-12/h1-3,7,12-13H,4-5H2,(H,14,15) |
| InChIKey | CXUWAVHKESRZFB-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |