C11H13BrO6S — CID 82850567
3-bromo-5-(2,3-dihydroxypropylsulfonyl)-4-methylbenzoic acid (PubChem CID 82850567) has the molecular formula C11H13BrO6S and a molecular weight of 353.19 g/mol. Its IUPAC name is 3-bromo-5-(2,3-dihydroxypropylsulfonyl)-4-methylbenzoic acid.
| Compound Name | 3-bromo-5-(2,3-dihydroxypropylsulfonyl)-4-methylbenzoic acid |
|---|---|
| PubChem CID | 82850567 |
| Molecular Formula | C11H13BrO6S |
| Molecular Weight | 353.19 g/mol |
| Exact Mass | 351.96 |
| IUPAC Name | 3-bromo-5-(2,3-dihydroxypropylsulfonyl)-4-methylbenzoic acid |
| SMILES | Cc1c(Br)cc(C(=O)O)cc1S(=O)(=O)CC(O)CO |
| InChI | InChI=1S/C11H13BrO6S/c1-6-9(12)2-7(11(15)16)3-10(6)19(17,18)5-8(14)4-13/h2-3,8,13-14H,4-5H2,1H3,(H,15,16) |
| InChIKey | LLGPYJUXIRWNKJ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.19 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |