C14H19BrO5S — CID 106454152
3-bromo-4-methyl-5-[2-(2-methylpropoxy)ethylsulfonyl]benzoic acid (PubChem CID 106454152) has the molecular formula C14H19BrO5S and a molecular weight of 379.27 g/mol. Its IUPAC name is 3-bromo-4-methyl-5-[2-(2-methylpropoxy)ethylsulfonyl]benzoic acid.
| Compound Name | 3-bromo-4-methyl-5-[2-(2-methylpropoxy)ethylsulfonyl]benzoic acid |
|---|---|
| PubChem CID | 106454152 |
| Molecular Formula | C14H19BrO5S |
| Molecular Weight | 379.27 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | 3-bromo-4-methyl-5-[2-(2-methylpropoxy)ethylsulfonyl]benzoic acid |
| SMILES | Cc1c(Br)cc(C(=O)O)cc1S(=O)(=O)CCOCC(C)C |
| InChI | InChI=1S/C14H19BrO5S/c1-9(2)8-20-4-5-21(18,19)13-7-11(14(16)17)6-12(15)10(13)3/h6-7,9H,4-5,8H2,1-3H3,(H,16,17) |
| InChIKey | PWUWVMWIPSSGHB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.27 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|