C12H16BrNO6S — CID 81479670
3-bromo-5-[2-(2-hydroxyethoxy)ethylsulfamoyl]-4-methylbenzoic acid (PubChem CID 81479670) has the molecular formula C12H16BrNO6S and a molecular weight of 382.23 g/mol. Its IUPAC name is 3-bromo-5-[2-(2-hydroxyethoxy)ethylsulfamoyl]-4-methylbenzoic acid.
| Compound Name | 3-bromo-5-[2-(2-hydroxyethoxy)ethylsulfamoyl]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 81479670 |
| Molecular Formula | C12H16BrNO6S |
| Molecular Weight | 382.23 g/mol |
| Exact Mass | 380.99 |
| IUPAC Name | 3-bromo-5-[2-(2-hydroxyethoxy)ethylsulfamoyl]-4-methylbenzoic acid |
| SMILES | Cc1c(Br)cc(C(=O)O)cc1S(=O)(=O)NCCOCCO |
| InChI | InChI=1S/C12H16BrNO6S/c1-8-10(13)6-9(12(16)17)7-11(8)21(18,19)14-2-4-20-5-3-15/h6-7,14-15H,2-5H2,1H3,(H,16,17) |
| InChIKey | JVDDMBYVJUSZOR-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.23 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|