C13H19NO6S — CID 62498475
3-[2-(2-hydroxyethoxy)ethylsulfamoyl]-4,5-dimethylbenzoic acid (PubChem CID 62498475) has the molecular formula C13H19NO6S and a molecular weight of 317.36 g/mol. Its IUPAC name is 3-[2-(2-hydroxyethoxy)ethylsulfamoyl]-4,5-dimethylbenzoic acid.
| Compound Name | 3-[2-(2-hydroxyethoxy)ethylsulfamoyl]-4,5-dimethylbenzoic acid |
|---|---|
| PubChem CID | 62498475 |
| Molecular Formula | C13H19NO6S |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 3-[2-(2-hydroxyethoxy)ethylsulfamoyl]-4,5-dimethylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)cc(S(=O)(=O)NCCOCCO)c1C |
| InChI | InChI=1S/C13H19NO6S/c1-9-7-11(13(16)17)8-12(10(9)2)21(18,19)14-3-5-20-6-4-15/h7-8,14-15H,3-6H2,1-2H3,(H,16,17) |
| InChIKey | LLESAUUQXWFNAS-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|